C20H17FN4O5 — CID 89278671
methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethylcarbamoylamino)-1,6-naphthyridine-7-carboxylate (PubChem CID 89278671) has the molecular formula C20H17FN4O5 and a molecular weight of 412.38 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethylcarbamoylamino)-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethylcarbamoylamino)-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 89278671 |
| Molecular Formula | C20H17FN4O5 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-(2-oxoethylcarbamoylamino)-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)NCC=O)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C20H17FN4O5/c1-30-19(28)16-17(27)15-14(18(24-16)25-20(29)22-6-7-26)9-12(10-23-15)8-11-2-4-13(21)5-3-11/h2-5,7,9-10,27H,6,8H2,1H3,(H2,22,24,25,29) |
| InChIKey | JSWPUGNEWACXRC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|