C25H23FN4O3 — CID 59696395
3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[4-(hydroxymethyl)phenyl]-N',N'-dimethyl-1,6-naphthyridine-7-carbohydrazide (PubChem CID 59696395) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[4-(hydroxymethyl)phenyl]-N',N'-dimethyl-1,6-naphthyridine-7-carbohydrazide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[4-(hydroxymethyl)phenyl]-N',N'-dimethyl-1,6-naphthyridine-7-carbohydrazide |
|---|---|
| PubChem CID | 59696395 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8-hydroxy-5-[4-(hydroxymethyl)phenyl]-N',N'-dimethyl-1,6-naphthyridine-7-carbohydrazide |
| SMILES | CN(C)NC(=O)c1nc(-c2ccc(CO)cc2)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C25H23FN4O3/c1-30(2)29-25(33)23-24(32)22-20(21(28-23)18-7-3-16(14-31)4-8-18)12-17(13-27-22)11-15-5-9-19(26)10-6-15/h3-10,12-13,31-32H,11,14H2,1-2H3,(H,29,33) |
| InChIKey | GFBGSXHOYVEZSK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|