About 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid
1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid (PubChem CID 143334734) has the molecular formula C16H21BN2O5
and a molecular weight of 332.16 g/mol. Its IUPAC name is 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid.
Molecular Properties
| Compound Name | 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid |
| PubChem CID | 143334734 |
| Molecular Formula | C16H21BN2O5 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid |
| SMILES | CCCN(C(=O)CN1C(=O)C2=C(CC=CC=C2)C1=O)C(C)B(O)O |
| InChI | InChI=1S/C16H21BN2O5/c1-3-9-18(11(2)17(23)24)14(20)10-19-15(21)12-7-5-4-6-8-13(12)16(19)22/h4-7,11,23-24H,3,8-10H2,1-2H3 |
| InChIKey | WDGLLLJDPJMHSS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid?
The IUPAC name of 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid (CID 143334734) is 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid.
What is the SMILES notation for 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid?
The canonical SMILES for 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid is CCCN(C(=O)CN1C(=O)C2=C(CC=CC=C2)C1=O)C(C)B(O)O.
What is the InChIKey of 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid?
The InChIKey is WDGLLLJDPJMHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BN2O5/c1-3-9-18(11(2)17(23)24)14(20)10-19-15(21)12-7-5-4-6-8-13(12)16(19)22/h4-7,11,23-24H,3,8-10H2,1-2H3.
What are the key properties of 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid?
1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid has a molecular weight of 332.16 g/mol, XLogP of -0.19, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(1,3-dioxo-8H-cyclohepta[c]pyrrol-2-yl)acetyl]-propylamino]ethylboronic acid is sourced from PubChem (CID 143334734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).