C16H24N2O2 — CID 20773233
1,7-ditert-butyl-3,6-dihydropyrrolo[2,3-c]azepine-2,8-dione (PubChem CID 20773233) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1,7-ditert-butyl-3,6-dihydropyrrolo[2,3-c]azepine-2,8-dione.
| Compound Name | 1,7-ditert-butyl-3,6-dihydropyrrolo[2,3-c]azepine-2,8-dione |
|---|---|
| PubChem CID | 20773233 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1,7-ditert-butyl-3,6-dihydropyrrolo[2,3-c]azepine-2,8-dione |
| SMILES | CC(C)(C)N1CC=CC2=C(C1=O)N(C(C)(C)C)C(=O)C2 |
| InChI | InChI=1S/C16H24N2O2/c1-15(2,3)17-9-7-8-11-10-12(19)18(16(4,5)6)13(11)14(17)20/h7-8H,9-10H2,1-6H3 |
| InChIKey | PLYKVGXZWXTOAZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |