C15H22N2O2 — CID 20773196
1,6-ditert-butyl-3H-pyrrolo[2,3-c]pyridine-2,7-dione (PubChem CID 20773196) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1,6-ditert-butyl-3H-pyrrolo[2,3-c]pyridine-2,7-dione.
| Compound Name | 1,6-ditert-butyl-3H-pyrrolo[2,3-c]pyridine-2,7-dione |
|---|---|
| PubChem CID | 20773196 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1,6-ditert-butyl-3H-pyrrolo[2,3-c]pyridine-2,7-dione |
| SMILES | CC(C)(C)N1C(=O)Cc2ccn(C(C)(C)C)c(=O)c21 |
| InChI | InChI=1S/C15H22N2O2/c1-14(2,3)16-8-7-10-9-11(18)17(15(4,5)6)12(10)13(16)19/h7-8H,9H2,1-6H3 |
| InChIKey | SJDXHZGOSPCGBE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |