C15H24N2O — CID 20773195
1,6-ditert-butyl-2,3-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 20773195) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1,6-ditert-butyl-2,3-dihydropyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 1,6-ditert-butyl-2,3-dihydropyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 20773195 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1,6-ditert-butyl-2,3-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | CC(C)(C)N1CCc2ccn(C(C)(C)C)c(=O)c21 |
| InChI | InChI=1S/C15H24N2O/c1-14(2,3)16-9-7-11-8-10-17(15(4,5)6)13(18)12(11)16/h8,10H,7,9H2,1-6H3 |
| InChIKey | DOKAINNSNNDYKC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |