C11H19IN2OS — CID 171650128
ethane;[(4-ethenyl-1-methyl-6-oxo-2,3-dihydropyridin-5-yl)-methylamino] thiohypoiodite (PubChem CID 171650128) has the molecular formula C11H19IN2OS and a molecular weight of 354.26 g/mol. Its IUPAC name is ethane;[(4-ethenyl-1-methyl-6-oxo-2,3-dihydropyridin-5-yl)-methylamino] thiohypoiodite.
| Compound Name | ethane;[(4-ethenyl-1-methyl-6-oxo-2,3-dihydropyridin-5-yl)-methylamino] thiohypoiodite |
|---|---|
| PubChem CID | 171650128 |
| Molecular Formula | C11H19IN2OS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | ethane;[(4-ethenyl-1-methyl-6-oxo-2,3-dihydropyridin-5-yl)-methylamino] thiohypoiodite |
| SMILES | C=CC1=C(N(C)SI)C(=O)N(C)CC1.CC |
| InChI | InChI=1S/C9H13IN2OS.C2H6/c1-4-7-5-6-11(2)9(13)8(7)12(3)14-10;1-2/h4H,1,5-6H2,2-3H3;1-2H3 |
| InChIKey | GRKYEDCXAIOJJZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|