C9H12N2O — CID 145416261
4-ethenyl-1-methyl-5-(methylideneamino)-2,3-dihydropyridin-6-one (PubChem CID 145416261) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-ethenyl-1-methyl-5-(methylideneamino)-2,3-dihydropyridin-6-one.
| Compound Name | 4-ethenyl-1-methyl-5-(methylideneamino)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 145416261 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-ethenyl-1-methyl-5-(methylideneamino)-2,3-dihydropyridin-6-one |
| SMILES | C=CC1=C(N=C)C(=O)N(C)CC1 |
| InChI | InChI=1S/C9H12N2O/c1-4-7-5-6-11(3)9(12)8(7)10-2/h4H,1-2,5-6H2,3H3 |
| InChIKey | JWOCUROSZVNPAA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|