C10H16N2O — CID 145416167
ethane;4-ethenyl-5-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one (PubChem CID 145416167) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane;4-ethenyl-5-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | ethane;4-ethenyl-5-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 145416167 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | ethane;4-ethenyl-5-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one |
| SMILES | C=CC1=C(N=C)C(=O)NCC1.CC |
| InChI | InChI=1S/C8H10N2O.C2H6/c1-3-6-4-5-10-8(11)7(6)9-2;1-2/h3H,1-2,4-5H2,(H,10,11);1-2H3 |
| InChIKey | PMOFTDWZFQEPGK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|