C14H19N3O — CID 91327061
ethyl-[6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2-oxo-1H-pyridin-3-yl]azanium (PubChem CID 91327061) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is ethyl-[6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2-oxo-1H-pyridin-3-yl]azanium.
| Compound Name | ethyl-[6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2-oxo-1H-pyridin-3-yl]azanium |
|---|---|
| PubChem CID | 91327061 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | ethyl-[6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2-oxo-1H-pyridin-3-yl]azanium |
| SMILES | C=N/C=C\C(=C/C)c1cc([NH2+][CH-]C)c(=O)[nH]c1C |
| InChI | InChI=1S/C14H19N3O/c1-5-11(7-8-15-4)12-9-13(16-6-2)14(18)17-10(12)3/h5-9H,4,16H2,1-3H3,(H,17,18)/b8-7-,11-5+ |
| InChIKey | CEACDADMVTWCCB-LTCQKBRTSA-N |
| XLogP | 1.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|