C10H16N2O — CID 143136259
ethane;5,6,7,8-tetrahydro-1H-1,7-naphthyridin-2-one (PubChem CID 143136259) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane;5,6,7,8-tetrahydro-1H-1,7-naphthyridin-2-one.
| Compound Name | ethane;5,6,7,8-tetrahydro-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 143136259 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | ethane;5,6,7,8-tetrahydro-1H-1,7-naphthyridin-2-one |
| SMILES | CC.O=c1ccc2c([nH]1)CNCC2 |
| InChI | InChI=1S/C8H10N2O.C2H6/c11-8-2-1-6-3-4-9-5-7(6)10-8;1-2/h1-2,9H,3-5H2,(H,10,11);1-2H3 |
| InChIKey | QJGGKZFFXBGZCP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |