C11H16N2O — CID 23391959
1,6-dimethyl-3-(methylideneamino)-5-propan-2-ylpyridin-2-one (PubChem CID 23391959) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,6-dimethyl-3-(methylideneamino)-5-propan-2-ylpyridin-2-one.
| Compound Name | 1,6-dimethyl-3-(methylideneamino)-5-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 23391959 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1,6-dimethyl-3-(methylideneamino)-5-propan-2-ylpyridin-2-one |
| SMILES | C=Nc1cc(C(C)C)c(C)n(C)c1=O |
| InChI | InChI=1S/C11H16N2O/c1-7(2)9-6-10(12-4)11(14)13(5)8(9)3/h6-7H,4H2,1-3,5H3 |
| InChIKey | OOHRPFVWPOCESD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|