C11H14N2O — CID 23391951
3-isocyano-1,6-dimethyl-5-propan-2-ylpyridin-2-one (PubChem CID 23391951) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-isocyano-1,6-dimethyl-5-propan-2-ylpyridin-2-one.
| Compound Name | 3-isocyano-1,6-dimethyl-5-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 23391951 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-isocyano-1,6-dimethyl-5-propan-2-ylpyridin-2-one |
| SMILES | [C-]#[N+]c1cc(C(C)C)c(C)n(C)c1=O |
| InChI | InChI=1S/C11H14N2O/c1-7(2)9-6-10(12-4)11(14)13(5)8(9)3/h6-7H,1-3,5H3 |
| InChIKey | BPZQIQABKCWINO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|