C18H31N3O — CID 171811580
(2Z,4Z)-4-methyl-2-(methylideneamino)-1-(4-prop-1-en-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one;propane (PubChem CID 171811580) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (2Z,4Z)-4-methyl-2-(methylideneamino)-1-(4-prop-1-en-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one;propane.
| Compound Name | (2Z,4Z)-4-methyl-2-(methylideneamino)-1-(4-prop-1-en-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one;propane |
|---|---|
| PubChem CID | 171811580 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (2Z,4Z)-4-methyl-2-(methylideneamino)-1-(4-prop-1-en-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one;propane |
| SMILES | C=N/C(=C\C(C)=C/C)C(=O)N1CCN(C(=C)C)CC1.CCC |
| InChI | InChI=1S/C15H23N3O.C3H8/c1-6-13(4)11-14(16-5)15(19)18-9-7-17(8-10-18)12(2)3;1-3-2/h6,11H,2,5,7-10H2,1,3-4H3;3H2,1-2H3/b13-6-,14-11-; |
| InChIKey | YFVRJAANMFUCHO-WXFGZMFZSA-N |
| XLogP | 3.63 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|