C16H25N3O2 — CID 171811352
4-[(2Z,4E)-4-tert-butyl-2-(methylideneamino)hexa-2,4-dienoyl]-1-methylpiperazin-2-one (PubChem CID 171811352) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-[(2Z,4E)-4-tert-butyl-2-(methylideneamino)hexa-2,4-dienoyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[(2Z,4E)-4-tert-butyl-2-(methylideneamino)hexa-2,4-dienoyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 171811352 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[(2Z,4E)-4-tert-butyl-2-(methylideneamino)hexa-2,4-dienoyl]-1-methylpiperazin-2-one |
| SMILES | C=N/C(=C\C(=C/C)C(C)(C)C)C(=O)N1CCN(C)C(=O)C1 |
| InChI | InChI=1S/C16H25N3O2/c1-7-12(16(2,3)4)10-13(17-5)15(21)19-9-8-18(6)14(20)11-19/h7,10H,5,8-9,11H2,1-4,6H3/b12-7+,13-10- |
| InChIKey | FJDKNUZSZGHFDG-JRYRHXBOSA-N |
| XLogP | 1.86 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|