C17H27N3O2 — CID 142321585
(3Z)-3-[(2E,4E)-5-amino-6,6-dimethyl-4-propan-2-ylhepta-2,4-dienylidene]-1-methylpiperazine-2,5-dione (PubChem CID 142321585) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3Z)-3-[(2E,4E)-5-amino-6,6-dimethyl-4-propan-2-ylhepta-2,4-dienylidene]-1-methylpiperazine-2,5-dione.
| Compound Name | (3Z)-3-[(2E,4E)-5-amino-6,6-dimethyl-4-propan-2-ylhepta-2,4-dienylidene]-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 142321585 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (3Z)-3-[(2E,4E)-5-amino-6,6-dimethyl-4-propan-2-ylhepta-2,4-dienylidene]-1-methylpiperazine-2,5-dione |
| SMILES | CC(C)C(/C=C/C=C1\NC(=O)CN(C)C1=O)=C(\N)C(C)(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-11(2)12(15(18)17(3,4)5)8-7-9-13-16(22)20(6)10-14(21)19-13/h7-9,11H,10,18H2,1-6H3,(H,19,21)/b8-7+,13-9-,15-12- |
| InChIKey | UNRULRHHOFPRKU-QWYAOWITSA-N |
| XLogP | 1.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|