C17H23F3N2O2 — CID 176553620
ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 176553620) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 176553620 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethane;N-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | C/C=C\C(=C/CC)NC(=O)Cn1cc(C(F)(F)F)ccc1=O.CC |
| InChI | InChI=1S/C15H17F3N2O2.C2H6/c1-3-5-12(6-4-2)19-13(21)10-20-9-11(15(16,17)18)7-8-14(20)22;1-2/h3,5-9H,4,10H2,1-2H3,(H,19,21);1-2H3/b5-3-,12-6+; |
| InChIKey | CGOGOXRMPIISIG-IXKMJOFVSA-N |
| XLogP | 3.88 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|