C17H28N2O — CID 20773236
1,8-ditert-butyl-2,3,4,7-tetrahydropyrido[2,3-c]azepin-9-one (PubChem CID 20773236) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,8-ditert-butyl-2,3,4,7-tetrahydropyrido[2,3-c]azepin-9-one.
| Compound Name | 1,8-ditert-butyl-2,3,4,7-tetrahydropyrido[2,3-c]azepin-9-one |
|---|---|
| PubChem CID | 20773236 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1,8-ditert-butyl-2,3,4,7-tetrahydropyrido[2,3-c]azepin-9-one |
| SMILES | CC(C)(C)N1CC=CC2=C(C1=O)N(C(C)(C)C)CCC2 |
| InChI | InChI=1S/C17H28N2O/c1-16(2,3)18-11-7-9-13-10-8-12-19(17(4,5)6)15(20)14(13)18/h8,10H,7,9,11-12H2,1-6H3 |
| InChIKey | WSOHSLNHIBQRFH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |