C19H28N2O — CID 129084014
2-(3-ethenyl-5-methyl-2-methylidene-1-pyridinyl)-3-methyl-N-pentylbut-2-enamide (PubChem CID 129084014) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-(3-ethenyl-5-methyl-2-methylidene-1-pyridinyl)-3-methyl-N-pentylbut-2-enamide.
| Compound Name | 2-(3-ethenyl-5-methyl-2-methylidene-1-pyridinyl)-3-methyl-N-pentylbut-2-enamide |
|---|---|
| PubChem CID | 129084014 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-(3-ethenyl-5-methyl-2-methylidene-1-pyridinyl)-3-methyl-N-pentylbut-2-enamide |
| SMILES | C=CC1=CC(C)=CN(C(C(=O)NCCCCC)=C(C)C)C1=C |
| InChI | InChI=1S/C19H28N2O/c1-7-9-10-11-20-19(22)18(14(3)4)21-13-15(5)12-17(8-2)16(21)6/h8,12-13H,2,6-7,9-11H2,1,3-5H3,(H,20,22) |
| InChIKey | ZSIJNPWZKXVBNJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|