C16H26N2O — CID 20773232
1,7-ditert-butyl-6,8-dihydro-3H-pyrrolo[2,3-c]azepin-2-one (PubChem CID 20773232) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 1,7-ditert-butyl-6,8-dihydro-3H-pyrrolo[2,3-c]azepin-2-one.
| Compound Name | 1,7-ditert-butyl-6,8-dihydro-3H-pyrrolo[2,3-c]azepin-2-one |
|---|---|
| PubChem CID | 20773232 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1,7-ditert-butyl-6,8-dihydro-3H-pyrrolo[2,3-c]azepin-2-one |
| SMILES | CC(C)(C)N1CC=CC2=C(C1)N(C(C)(C)C)C(=O)C2 |
| InChI | InChI=1S/C16H26N2O/c1-15(2,3)17-9-7-8-12-10-14(19)18(13(12)11-17)16(4,5)6/h7-8H,9-11H2,1-6H3 |
| InChIKey | FLOHCRLXTCJTTG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |