C11H13NO — CID 143618185
1,6-dimethyl-3,6-dihydrocyclohepta[b]pyrrol-2-one (PubChem CID 143618185) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,6-dimethyl-3,6-dihydrocyclohepta[b]pyrrol-2-one.
| Compound Name | 1,6-dimethyl-3,6-dihydrocyclohepta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 143618185 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1,6-dimethyl-3,6-dihydrocyclohepta[b]pyrrol-2-one |
| SMILES | CC1C=CC2=C(C=C1)N(C)C(=O)C2 |
| InChI | InChI=1S/C11H13NO/c1-8-3-5-9-7-11(13)12(2)10(9)6-4-8/h3-6,8H,7H2,1-2H3 |
| InChIKey | HDYWSIJKXOTSPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |