About 8-methyl-7H-pyrido[1,2-a]azepin-6-one
8-methyl-7H-pyrido[1,2-a]azepin-6-one (PubChem CID 15129811) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 8-methyl-7H-pyrido[1,2-a]azepin-6-one.
Molecular Properties
| Compound Name | 8-methyl-7H-pyrido[1,2-a]azepin-6-one |
| PubChem CID | 15129811 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 8-methyl-7H-pyrido[1,2-a]azepin-6-one |
| SMILES | CC1=CC=C2C=CC=CN2C(=O)C1 |
| InChI | InChI=1S/C11H11NO/c1-9-5-6-10-4-2-3-7-12(10)11(13)8-9/h2-7H,8H2,1H3 |
| InChIKey | LABGKCXUVZMPKH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methyl-7H-pyrido[1,2-a]azepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-7H-pyrido[1,2-a]azepin-6-one?
The IUPAC name of 8-methyl-7H-pyrido[1,2-a]azepin-6-one (CID 15129811) is 8-methyl-7H-pyrido[1,2-a]azepin-6-one.
What is the SMILES notation for 8-methyl-7H-pyrido[1,2-a]azepin-6-one?
The canonical SMILES for 8-methyl-7H-pyrido[1,2-a]azepin-6-one is CC1=CC=C2C=CC=CN2C(=O)C1.
What is the InChIKey of 8-methyl-7H-pyrido[1,2-a]azepin-6-one?
The InChIKey is LABGKCXUVZMPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-9-5-6-10-4-2-3-7-12(10)11(13)8-9/h2-7H,8H2,1H3.
What are the key properties of 8-methyl-7H-pyrido[1,2-a]azepin-6-one?
8-methyl-7H-pyrido[1,2-a]azepin-6-one has a molecular weight of 173.21 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-7H-pyrido[1,2-a]azepin-6-one is sourced from PubChem (CID 15129811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).