C8H11NO — CID 11469112
1,5-dimethyl-3H-azepin-2-one (PubChem CID 11469112) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,5-dimethyl-3H-azepin-2-one.
| Compound Name | 1,5-dimethyl-3H-azepin-2-one |
|---|---|
| PubChem CID | 11469112 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,5-dimethyl-3H-azepin-2-one |
| SMILES | CC1=CCC(=O)N(C)C=C1 |
| InChI | InChI=1S/C8H11NO/c1-7-3-4-8(10)9(2)6-5-7/h3,5-6H,4H2,1-2H3 |
| InChIKey | ARHKZFNQXUWMBD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |