C13H18KNO — CID 153340929
potassium;1,6-dimethyl-3H-cyclohepta[b]pyrrol-6-id-2-one;ethane (PubChem CID 153340929) has the molecular formula C13H18KNO and a molecular weight of 243.39 g/mol. Its IUPAC name is potassium;1,6-dimethyl-3H-cyclohepta[b]pyrrol-6-id-2-one;ethane.
| Compound Name | potassium;1,6-dimethyl-3H-cyclohepta[b]pyrrol-6-id-2-one;ethane |
|---|---|
| PubChem CID | 153340929 |
| Molecular Formula | C13H18KNO |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | potassium;1,6-dimethyl-3H-cyclohepta[b]pyrrol-6-id-2-one;ethane |
| SMILES | CC.C[C-]1C=CC2=C(C=C1)N(C)C(=O)C2.[K+] |
| InChI | InChI=1S/C11H12NO.C2H6.K/c1-8-3-5-9-7-11(13)12(2)10(9)6-4-8;1-2;/h3-6H,7H2,1-2H3;1-2H3;/q-1;;+1 |
| InChIKey | NPQUCERTDDIZJD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|