C17H33NO — CID 144584614
ethane;1-methyl-4,5-bis[(Z)-prop-1-enyl]-3H-pyrrol-2-one (PubChem CID 144584614) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is ethane;1-methyl-4,5-bis[(Z)-prop-1-enyl]-3H-pyrrol-2-one.
| Compound Name | ethane;1-methyl-4,5-bis[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
|---|---|
| PubChem CID | 144584614 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | ethane;1-methyl-4,5-bis[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
| SMILES | C/C=C\C1=C(/C=C\C)N(C)C(=O)C1.CC.CC.CC |
| InChI | InChI=1S/C11H15NO.3C2H6/c1-4-6-9-8-11(13)12(3)10(9)7-5-2;3*1-2/h4-7H,8H2,1-3H3;3*1-2H3/b6-4-,7-5-;;; |
| InChIKey | KJYXNMVBEYNXTP-AANDKTPFSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |