C13H23NO — CID 138546730
(E,3Z)-N,N-diethyl-3-ethylidenehept-4-enamide (PubChem CID 138546730) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (E,3Z)-N,N-diethyl-3-ethylidenehept-4-enamide.
| Compound Name | (E,3Z)-N,N-diethyl-3-ethylidenehept-4-enamide |
|---|---|
| PubChem CID | 138546730 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (E,3Z)-N,N-diethyl-3-ethylidenehept-4-enamide |
| SMILES | C/C=C(\C=C\CC)CC(=O)N(CC)CC |
| InChI | InChI=1S/C13H23NO/c1-5-9-10-12(6-2)11-13(15)14(7-3)8-4/h6,9-10H,5,7-8,11H2,1-4H3/b10-9+,12-6+ |
| InChIKey | DWAWNOZMSOXGOO-AYCKBHPDSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|