C19H26FNO — CID 166126655
3-ethenyl-N-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-N,4-dimethyl-2-propan-2-ylidenepent-3-enamide (PubChem CID 166126655) has the molecular formula C19H26FNO and a molecular weight of 303.42 g/mol. Its IUPAC name is 3-ethenyl-N-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-N,4-dimethyl-2-propan-2-ylidenepent-3-enamide.
| Compound Name | 3-ethenyl-N-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-N,4-dimethyl-2-propan-2-ylidenepent-3-enamide |
|---|---|
| PubChem CID | 166126655 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 3-ethenyl-N-[(2Z,4Z)-3-fluorohepta-2,4,6-trien-2-yl]-N,4-dimethyl-2-propan-2-ylidenepent-3-enamide |
| SMILES | C=C/C=C\C(F)=C(/C)N(C)C(=O)C(=C(C)C)C(C=C)=C(C)C |
| InChI | InChI=1S/C19H26FNO/c1-9-11-12-17(20)15(7)21(8)19(22)18(14(5)6)16(10-2)13(3)4/h9-12H,1-2H2,3-8H3/b12-11-,17-15- |
| InChIKey | YLXPYVKTNCUWJI-MMHKUDGTSA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|