C24H29F3N2O — CID 143533929
4-[(1Z)-1-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]-3-(trifluoromethyl)buta-1,3-dienyl]-N,N-dimethylcyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 143533929) has the molecular formula C24H29F3N2O and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[(1Z)-1-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]-3-(trifluoromethyl)buta-1,3-dienyl]-N,N-dimethylcyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 4-[(1Z)-1-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]-3-(trifluoromethyl)buta-1,3-dienyl]-N,N-dimethylcyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 143533929 |
| Molecular Formula | C24H29F3N2O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 4-[(1Z)-1-[[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-methylamino]-3-(trifluoromethyl)buta-1,3-dienyl]-N,N-dimethylcyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | C=C/C(=C\C=C/C)CN(C)/C(=C\C(=C)C(F)(F)F)C1=CC=C(C(=O)N(C)C)C=CC1 |
| InChI | InChI=1S/C24H29F3N2O/c1-7-9-11-19(8-2)17-29(6)22(16-18(3)24(25,26)27)20-12-10-13-21(15-14-20)23(30)28(4)5/h7-11,13-16H,2-3,12,17H2,1,4-6H3/b9-7-,19-11+,22-16- |
| InChIKey | MGRUYLOCTZXSCL-SDYFFBDXSA-N |
| XLogP | 5.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|