C15H17F2NO — CID 91164440
5-(difluoromethyl)-1-(3-methylideneocta-4,6-dien-4-yl)pyridin-2-one (PubChem CID 91164440) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(3-methylideneocta-4,6-dien-4-yl)pyridin-2-one.
| Compound Name | 5-(difluoromethyl)-1-(3-methylideneocta-4,6-dien-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 91164440 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 5-(difluoromethyl)-1-(3-methylideneocta-4,6-dien-4-yl)pyridin-2-one |
| SMILES | C=C(CC)C(=CC=CC)n1cc(C(F)F)ccc1=O |
| InChI | InChI=1S/C15H17F2NO/c1-4-6-7-13(11(3)5-2)18-10-12(15(16)17)8-9-14(18)19/h4,6-10,15H,3,5H2,1-2H3 |
| InChIKey | CBTXJNQMZUUIFI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|