C22H31F3N2O — CID 143534031
(2E,4E,5Z)-5-[cyclopentyl(methyl)amino]-2-ethenyl-N,N-dimethyl-4-propylidene-7-(trifluoromethyl)octa-2,5,7-trienamide (PubChem CID 143534031) has the molecular formula C22H31F3N2O and a molecular weight of 396.50 g/mol. Its IUPAC name is (2E,4E,5Z)-5-[cyclopentyl(methyl)amino]-2-ethenyl-N,N-dimethyl-4-propylidene-7-(trifluoromethyl)octa-2,5,7-trienamide.
| Compound Name | (2E,4E,5Z)-5-[cyclopentyl(methyl)amino]-2-ethenyl-N,N-dimethyl-4-propylidene-7-(trifluoromethyl)octa-2,5,7-trienamide |
|---|---|
| PubChem CID | 143534031 |
| Molecular Formula | C22H31F3N2O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (2E,4E,5Z)-5-[cyclopentyl(methyl)amino]-2-ethenyl-N,N-dimethyl-4-propylidene-7-(trifluoromethyl)octa-2,5,7-trienamide |
| SMILES | C=C/C(=C\C(=C/CC)\C(=C\C(=C)C(F)(F)F)N(C)C1CCCC1)C(=O)N(C)C |
| InChI | InChI=1S/C22H31F3N2O/c1-7-11-18(15-17(8-2)21(28)26(4)5)20(14-16(3)22(23,24)25)27(6)19-12-9-10-13-19/h8,11,14-15,19H,2-3,7,9-10,12-13H2,1,4-6H3/b17-15+,18-11+,20-14- |
| InChIKey | JVSVEGQDWYBZJV-FQEAKDOPSA-N |
| XLogP | 5.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|