C10H12F3NO — CID 134419157
3-ethyl-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one (PubChem CID 134419157) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 3-ethyl-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-ethyl-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 134419157 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-ethyl-1,6-dimethyl-4-(trifluoromethyl)pyridin-2-one |
| SMILES | CCc1c(C(F)(F)F)cc(C)n(C)c1=O |
| InChI | InChI=1S/C10H12F3NO/c1-4-7-8(10(11,12)13)5-6(2)14(3)9(7)15/h5H,4H2,1-3H3 |
| InChIKey | CGWVSEPDAOCYEP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |