C8H7F3INOZn — CID 134859364
1,6-dimethyl-4-(trifluoromethyl)-3H-pyridin-3-id-2-one;iodozinc(1+) (PubChem CID 134859364) has the molecular formula C8H7F3INOZn and a molecular weight of 382.44 g/mol. Its IUPAC name is 1,6-dimethyl-4-(trifluoromethyl)-3H-pyridin-3-id-2-one;iodozinc(1+).
| Compound Name | 1,6-dimethyl-4-(trifluoromethyl)-3H-pyridin-3-id-2-one;iodozinc(1+) |
|---|---|
| PubChem CID | 134859364 |
| Molecular Formula | C8H7F3INOZn |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 380.88 |
| IUPAC Name | 1,6-dimethyl-4-(trifluoromethyl)-3H-pyridin-3-id-2-one;iodozinc(1+) |
| SMILES | Cc1cc(C(F)(F)F)[c-]c(=O)n1C.[Zn+]I |
| InChI | InChI=1S/C8H7F3NO.HI.Zn/c1-5-3-6(8(9,10)11)4-7(13)12(5)2;;/h3H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | IADFMLIUGGIDKZ-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|