C8H7F3INO — CID 22382033
1,4-Dimethyl-3-iodo-6-(trifluoromethyl)-2-pyridone (PubChem CID 22382033) has the molecular formula C8H7F3INO and a molecular weight of 317.05 g/mol. Its IUPAC name is 3-iodo-1,4-dimethyl-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1,4-Dimethyl-3-iodo-6-(trifluoromethyl)-2-pyridone |
|---|---|
| PubChem CID | 22382033 |
| Molecular Formula | C8H7F3INO |
| Molecular Weight | 317.05 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 3-iodo-1,4-dimethyl-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CC1=C(C(=O)N(C(=C1)C(F)(F)F)C)I |
| InChI | InChI=1S/C8H7F3INO/c1-4-3-5(8(9,10)11)13(2)7(14)6(4)12/h3H,1-2H3 |
| InChIKey | SBSGCVBUURJOSB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 343 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.05 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|