About 4-fluoro-1,3,6-trimethylpyridin-2-one
4-fluoro-1,3,6-trimethylpyridin-2-one (PubChem CID 22890216) has the molecular formula C8H10FNO
and a molecular weight of 155.17 g/mol. Its IUPAC name is 4-fluoro-1,3,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 4-fluoro-1,3,6-trimethylpyridin-2-one |
| PubChem CID | 22890216 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4-fluoro-1,3,6-trimethylpyridin-2-one |
| SMILES | Cc1c(F)cc(C)n(C)c1=O |
| InChI | InChI=1S/C8H10FNO/c1-5-4-7(9)6(2)8(11)10(5)3/h4H,1-3H3 |
| InChIKey | QAFSQTOXPNDNDC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-1,3,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,3,6-trimethylpyridin-2-one?
The IUPAC name of 4-fluoro-1,3,6-trimethylpyridin-2-one (CID 22890216) is 4-fluoro-1,3,6-trimethylpyridin-2-one.
What is the SMILES notation for 4-fluoro-1,3,6-trimethylpyridin-2-one?
The canonical SMILES for 4-fluoro-1,3,6-trimethylpyridin-2-one is Cc1c(F)cc(C)n(C)c1=O.
What is the InChIKey of 4-fluoro-1,3,6-trimethylpyridin-2-one?
The InChIKey is QAFSQTOXPNDNDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO/c1-5-4-7(9)6(2)8(11)10(5)3/h4H,1-3H3.
What are the key properties of 4-fluoro-1,3,6-trimethylpyridin-2-one?
4-fluoro-1,3,6-trimethylpyridin-2-one has a molecular weight of 155.17 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,3,6-trimethylpyridin-2-one is sourced from PubChem (CID 22890216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).