C10H21N3O — CID 143336148
(Z)-2,3-bis(methylideneamino)prop-2-enal;N,N-dimethylmethanamine;ethane (PubChem CID 143336148) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is (Z)-2,3-bis(methylideneamino)prop-2-enal;N,N-dimethylmethanamine;ethane.
| Compound Name | (Z)-2,3-bis(methylideneamino)prop-2-enal;N,N-dimethylmethanamine;ethane |
|---|---|
| PubChem CID | 143336148 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (Z)-2,3-bis(methylideneamino)prop-2-enal;N,N-dimethylmethanamine;ethane |
| SMILES | C=N/C=C(/C=O)N=C.CC.CN(C)C |
| InChI | InChI=1S/C5H6N2O.C3H9N.C2H6/c1-6-3-5(4-8)7-2;1-4(2)3;1-2/h3-4H,1-2H2;1-3H3;1-2H3/b5-3-;; |
| InChIKey | AHROBUWSQWWZRJ-ORIPCLHRSA-N |
| XLogP | 1.63 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|