About (Z)-2,3-bis(methylideneamino)prop-2-enal
(Z)-2,3-bis(methylideneamino)prop-2-enal (PubChem CID 143336149) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is (Z)-2,3-bis(methylideneamino)prop-2-enal.
Molecular Properties
| Compound Name | (Z)-2,3-bis(methylideneamino)prop-2-enal |
| PubChem CID | 143336149 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | (Z)-2,3-bis(methylideneamino)prop-2-enal |
| SMILES | C=N/C=C(/C=O)N=C |
| InChI | InChI=1S/C5H6N2O/c1-6-3-5(4-8)7-2/h3-4H,1-2H2/b5-3- |
| InChIKey | FUEMPTZDOCQHOA-HYXAFXHYSA-N |
| XLogP | 0.43 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-bis(methylideneamino)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-bis(methylideneamino)prop-2-enal?
The IUPAC name of (Z)-2,3-bis(methylideneamino)prop-2-enal (CID 143336149) is (Z)-2,3-bis(methylideneamino)prop-2-enal.
What is the SMILES notation for (Z)-2,3-bis(methylideneamino)prop-2-enal?
The canonical SMILES for (Z)-2,3-bis(methylideneamino)prop-2-enal is C=N/C=C(/C=O)N=C.
What is the InChIKey of (Z)-2,3-bis(methylideneamino)prop-2-enal?
The InChIKey is FUEMPTZDOCQHOA-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H6N2O/c1-6-3-5(4-8)7-2/h3-4H,1-2H2/b5-3-.
What are the key properties of (Z)-2,3-bis(methylideneamino)prop-2-enal?
(Z)-2,3-bis(methylideneamino)prop-2-enal has a molecular weight of 110.12 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-bis(methylideneamino)prop-2-enal is sourced from PubChem (CID 143336149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).