C27H32N4O7 — CID 143336261
tert-butyl N-[(Z)-3-imino-3-[[3-[(3-methyl-4-oxo-2H-1,3-benzoxazin-7-yl)oxy]-5-propan-2-yloxybenzoyl]amino]prop-1-enyl]carbamate (PubChem CID 143336261) has the molecular formula C27H32N4O7 and a molecular weight of 524.57 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3-imino-3-[[3-[(3-methyl-4-oxo-2H-1,3-benzoxazin-7-yl)oxy]-5-propan-2-yloxybenzoyl]amino]prop-1-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-3-imino-3-[[3-[(3-methyl-4-oxo-2H-1,3-benzoxazin-7-yl)oxy]-5-propan-2-yloxybenzoyl]amino]prop-1-enyl]carbamate |
|---|---|
| PubChem CID | 143336261 |
| Molecular Formula | C27H32N4O7 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | tert-butyl N-[(Z)-3-imino-3-[[3-[(3-methyl-4-oxo-2H-1,3-benzoxazin-7-yl)oxy]-5-propan-2-yloxybenzoyl]amino]prop-1-enyl]carbamate |
| SMILES | [H]/N=C(\C=C/NC(=O)OC(C)(C)C)NC(=O)c1cc(Oc2ccc3c(c2)OCN(C)C3=O)cc(OC(C)C)c1 |
| InChI | InChI=1S/C27H32N4O7/c1-16(2)36-19-11-17(24(32)30-23(28)9-10-29-26(34)38-27(3,4)5)12-20(13-19)37-18-7-8-21-22(14-18)35-15-31(6)25(21)33/h7-14,16H,15H2,1-6H3,(H,29,34)(H2,28,30,32)/b10-9- |
| InChIKey | FSQGFGWATACYBL-KTKRTIGZSA-N |
| XLogP | 4.43 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|