About (Z)-3-fluorooct-4-ene
(Z)-3-fluorooct-4-ene (PubChem CID 143337170) has the molecular formula C8H15F
and a molecular weight of 130.21 g/mol. Its IUPAC name is (Z)-3-fluorooct-4-ene.
Molecular Properties
| Compound Name | (Z)-3-fluorooct-4-ene |
| PubChem CID | 143337170 |
| Molecular Formula | C8H15F |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | (Z)-3-fluorooct-4-ene |
| SMILES | CCC/C=C\C(F)CC |
| InChI | InChI=1S/C8H15F/c1-3-5-6-7-8(9)4-2/h6-8H,3-5H2,1-2H3/b7-6- |
| InChIKey | ULRRSRQHEUJRFI-SREVYHEPSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-fluorooct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-fluorooct-4-ene?
The IUPAC name of (Z)-3-fluorooct-4-ene (CID 143337170) is (Z)-3-fluorooct-4-ene.
What is the SMILES notation for (Z)-3-fluorooct-4-ene?
The canonical SMILES for (Z)-3-fluorooct-4-ene is CCC/C=C\C(F)CC.
What is the InChIKey of (Z)-3-fluorooct-4-ene?
The InChIKey is ULRRSRQHEUJRFI-SREVYHEPSA-N. The full InChI is InChI=1S/C8H15F/c1-3-5-6-7-8(9)4-2/h6-8H,3-5H2,1-2H3/b7-6-.
What are the key properties of (Z)-3-fluorooct-4-ene?
(Z)-3-fluorooct-4-ene has a molecular weight of 130.21 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-fluorooct-4-ene is sourced from PubChem (CID 143337170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).