C10H15NO4S — CID 143339369
(3S,5S)-3-hydroxy-5-(hydroxymethyl)-N-(3-oxobut-1-en-2-yl)oxolane-2-carbothioamide (PubChem CID 143339369) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (3S,5S)-3-hydroxy-5-(hydroxymethyl)-N-(3-oxobut-1-en-2-yl)oxolane-2-carbothioamide.
| Compound Name | (3S,5S)-3-hydroxy-5-(hydroxymethyl)-N-(3-oxobut-1-en-2-yl)oxolane-2-carbothioamide |
|---|---|
| PubChem CID | 143339369 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3S,5S)-3-hydroxy-5-(hydroxymethyl)-N-(3-oxobut-1-en-2-yl)oxolane-2-carbothioamide |
| SMILES | C=C(NC(=S)C1O[C@H](CO)C[C@@H]1O)C(C)=O |
| InChI | InChI=1S/C10H15NO4S/c1-5(6(2)13)11-10(16)9-8(14)3-7(4-12)15-9/h7-9,12,14H,1,3-4H2,2H3,(H,11,16)/t7-,8-,9?/m0/s1 |
| InChIKey | IHFDMALUSFUOFZ-JVIMKECRSA-N |
| XLogP | -0.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|