C20H30N2O2 — CID 143342381
(Z)-5-amino-4-(3,6-diethyl-3-methyl-2H-indol-1-yl)pent-4-ene-2,3-dione;ethane (PubChem CID 143342381) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (Z)-5-amino-4-(3,6-diethyl-3-methyl-2H-indol-1-yl)pent-4-ene-2,3-dione;ethane.
| Compound Name | (Z)-5-amino-4-(3,6-diethyl-3-methyl-2H-indol-1-yl)pent-4-ene-2,3-dione;ethane |
|---|---|
| PubChem CID | 143342381 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (Z)-5-amino-4-(3,6-diethyl-3-methyl-2H-indol-1-yl)pent-4-ene-2,3-dione;ethane |
| SMILES | CC.CCc1ccc2c(c1)N(/C(=C\N)C(=O)C(C)=O)CC2(C)CC |
| InChI | InChI=1S/C18H24N2O2.C2H6/c1-5-13-7-8-14-15(9-13)20(11-18(14,4)6-2)16(10-19)17(22)12(3)21;1-2/h7-10H,5-6,11,19H2,1-4H3;1-2H3/b16-10-; |
| InChIKey | IVDCCXMXUZIWIG-HYMQDMCPSA-N |
| XLogP | 3.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|