C20H32N2O3 — CID 143588155
(Z)-3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)hex-3-ene-2,5-dione;ethane (PubChem CID 143588155) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is (Z)-3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)hex-3-ene-2,5-dione;ethane.
| Compound Name | (Z)-3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)hex-3-ene-2,5-dione;ethane |
|---|---|
| PubChem CID | 143588155 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (Z)-3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)hex-3-ene-2,5-dione;ethane |
| SMILES | CC.CC.CCc1ccc2c(c1)N(/C(C(C)=O)=C(\N)C(C)=O)CCO2 |
| InChI | InChI=1S/C16H20N2O3.2C2H6/c1-4-12-5-6-14-13(9-12)18(7-8-21-14)16(11(3)20)15(17)10(2)19;2*1-2/h5-6,9H,4,7-8,17H2,1-3H3;2*1-2H3/b16-15-;; |
| InChIKey | CNEBVRXSSDUEGF-NDXGFPCWSA-N |
| XLogP | 3.85 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|