C14H16N2O3 — CID 143587835
3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)cyclobutane-1,2-dione (PubChem CID 143587835) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)cyclobutane-1,2-dione.
| Compound Name | 3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)cyclobutane-1,2-dione |
|---|---|
| PubChem CID | 143587835 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-amino-4-(6-ethyl-2,3-dihydro-1,4-benzoxazin-4-yl)cyclobutane-1,2-dione |
| SMILES | CCc1ccc2c(c1)N(C1C(=O)C(=O)C1N)CCO2 |
| InChI | InChI=1S/C14H16N2O3/c1-2-8-3-4-10-9(7-8)16(5-6-19-10)12-11(15)13(17)14(12)18/h3-4,7,11-12H,2,5-6,15H2,1H3 |
| InChIKey | ZLYAMOJYOKOYET-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|