C15H17N2O3+ — CID 143587698
[2-(7-ethyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-3,4-dioxocyclobuten-1-yl]azanium (PubChem CID 143587698) has the molecular formula C15H17N2O3+ and a molecular weight of 273.31 g/mol. Its IUPAC name is [2-(7-ethyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-3,4-dioxocyclobuten-1-yl]azanium.
| Compound Name | [2-(7-ethyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-3,4-dioxocyclobuten-1-yl]azanium |
|---|---|
| PubChem CID | 143587698 |
| Molecular Formula | C15H17N2O3+ |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | [2-(7-ethyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl)-3,4-dioxocyclobuten-1-yl]azanium |
| SMILES | CCc1ccc2c(c1)N(c1c([NH3+])c(=O)c1=O)CCCO2 |
| InChI | InChI=1S/C15H16N2O3/c1-2-9-4-5-11-10(8-9)17(6-3-7-20-11)13-12(16)14(18)15(13)19/h4-5,8H,2-3,6-7,16H2,1H3/p+1 |
| InChIKey | YJGHVTVIHCADAT-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|