C11H15NO2 — CID 143588706
7-ethyl-5-methyl-4H-1,3,5-benzodioxazepine (PubChem CID 143588706) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 7-ethyl-5-methyl-4H-1,3,5-benzodioxazepine.
| Compound Name | 7-ethyl-5-methyl-4H-1,3,5-benzodioxazepine |
|---|---|
| PubChem CID | 143588706 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 7-ethyl-5-methyl-4H-1,3,5-benzodioxazepine |
| SMILES | CCc1ccc2c(c1)N(C)COCO2 |
| InChI | InChI=1S/C11H15NO2/c1-3-9-4-5-11-10(6-9)12(2)7-13-8-14-11/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | AVNTZGCEFIYALL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |