C21H24Br2O2 — CID 134885244
2,3-dibromo-6,18-diethyl-10,14-dioxatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene (PubChem CID 134885244) has the molecular formula C21H24Br2O2 and a molecular weight of 468.23 g/mol. Its IUPAC name is 2,3-dibromo-6,18-diethyl-10,14-dioxatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene.
| Compound Name | 2,3-dibromo-6,18-diethyl-10,14-dioxatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene |
|---|---|
| PubChem CID | 134885244 |
| Molecular Formula | C21H24Br2O2 |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 2,3-dibromo-6,18-diethyl-10,14-dioxatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene |
| SMILES | CCc1ccc2c(c1)C(Br)C(Br)c1cc(CC)ccc1OCCCO2 |
| InChI | InChI=1S/C21H24Br2O2/c1-3-14-6-8-18-16(12-14)20(22)21(23)17-13-15(4-2)7-9-19(17)25-11-5-10-24-18/h6-9,12-13,20-21H,3-5,10-11H2,1-2H3 |
| InChIKey | JOYBMECHCLTSQT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|