C22H33N5 — CID 143343417
N'-(3-aminopent-1-en-4-yn-2-yl)-N-[2-[[(E)-3-(4-ethyl-2-methyl-3H-pyrrol-5-yl)-2-methylprop-2-enyl]amino]prop-2-enyl]-N-methylethanimidamide (PubChem CID 143343417) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is N'-(3-aminopent-1-en-4-yn-2-yl)-N-[2-[[(E)-3-(4-ethyl-2-methyl-3H-pyrrol-5-yl)-2-methylprop-2-enyl]amino]prop-2-enyl]-N-methylethanimidamide.
| Compound Name | N'-(3-aminopent-1-en-4-yn-2-yl)-N-[2-[[(E)-3-(4-ethyl-2-methyl-3H-pyrrol-5-yl)-2-methylprop-2-enyl]amino]prop-2-enyl]-N-methylethanimidamide |
|---|---|
| PubChem CID | 143343417 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | N'-(3-aminopent-1-en-4-yn-2-yl)-N-[2-[[(E)-3-(4-ethyl-2-methyl-3H-pyrrol-5-yl)-2-methylprop-2-enyl]amino]prop-2-enyl]-N-methylethanimidamide |
| SMILES | C#CC(N)C(=C)/N=C(\C)N(C)CC(=C)NC/C(C)=C/C1=C(CC)CC(C)=N1 |
| InChI | InChI=1S/C22H33N5/c1-9-20-12-16(4)25-22(20)11-15(3)13-24-17(5)14-27(8)19(7)26-18(6)21(23)10-2/h2,11,21,24H,5-6,9,12-14,23H2,1,3-4,7-8H3/b15-11+,26-19+ |
| InChIKey | KMQKBEYJXVWBEW-WTRLBZMBSA-N |
| XLogP | 3.39 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|