C25H37N5 — CID 143342904
N-[1-[(E)-2-[[(3E,5Z)-3,5-dimethylocta-3,5-dien-7-ynyl]amino]pent-1-en-3-ylideneamino]ethenyl]-N'-methyl-N-[3-(methylamino)buta-1,3-dien-2-yl]ethanimidamide (PubChem CID 143342904) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is N-[1-[(E)-2-[[(3E,5Z)-3,5-dimethylocta-3,5-dien-7-ynyl]amino]pent-1-en-3-ylideneamino]ethenyl]-N'-methyl-N-[3-(methylamino)buta-1,3-dien-2-yl]ethanimidamide.
| Compound Name | N-[1-[(E)-2-[[(3E,5Z)-3,5-dimethylocta-3,5-dien-7-ynyl]amino]pent-1-en-3-ylideneamino]ethenyl]-N'-methyl-N-[3-(methylamino)buta-1,3-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143342904 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | N-[1-[(E)-2-[[(3E,5Z)-3,5-dimethylocta-3,5-dien-7-ynyl]amino]pent-1-en-3-ylideneamino]ethenyl]-N'-methyl-N-[3-(methylamino)buta-1,3-dien-2-yl]ethanimidamide |
| SMILES | C#C/C=C(C)\C=C(/C)CCNC(=C)/C(CC)=N/C(=C)N(C(=C)C(=C)NC)/C(C)=N/C |
| InChI | InChI=1S/C25H37N5/c1-12-14-18(3)17-19(4)15-16-28-21(6)25(13-2)29-24(9)30(23(8)27-11)22(7)20(5)26-10/h1,14,17,26,28H,5-7,9,13,15-16H2,2-4,8,10-11H3/b18-14-,19-17+,27-23+,29-25+ |
| InChIKey | WRHIKBKZOWIOIS-HLGNMKQVSA-N |
| XLogP | 4.92 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|