C25H46 — CID 143343476
1,3-dimethyl-4-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;2-methyl-6-propan-2-ylbicyclo[3.2.0]heptane (PubChem CID 143343476) has the molecular formula C25H46 and a molecular weight of 346.64 g/mol. Its IUPAC name is 1,3-dimethyl-4-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;2-methyl-6-propan-2-ylbicyclo[3.2.0]heptane.
| Compound Name | 1,3-dimethyl-4-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;2-methyl-6-propan-2-ylbicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 143343476 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | 1,3-dimethyl-4-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;2-methyl-6-propan-2-ylbicyclo[3.2.0]heptane |
| SMILES | CC(C)C1CC2C(C)CCC12.CC(C)C1CCCC2C(C)CC(C)C12 |
| InChI | InChI=1S/C14H26.C11H20/c1-9(2)12-6-5-7-13-10(3)8-11(4)14(12)13;1-7(2)10-6-11-8(3)4-5-9(10)11/h9-14H,5-8H2,1-4H3;7-11H,4-6H2,1-3H3 |
| InChIKey | OQUFVSKEBYGNEJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |