C28H33N7O3S — CID 143344545
5-N-[(3Z,5E)-6-cyano-3-methylsulfanylhexa-3,5-dien-2-yl]-7-N-[(3E,8E)-4,9-dimethyl-11-oxoundeca-1,3,8-trien-5-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143344545) has the molecular formula C28H33N7O3S and a molecular weight of 547.69 g/mol. Its IUPAC name is 5-N-[(3Z,5E)-6-cyano-3-methylsulfanylhexa-3,5-dien-2-yl]-7-N-[(3E,8E)-4,9-dimethyl-11-oxoundeca-1,3,8-trien-5-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 5-N-[(3Z,5E)-6-cyano-3-methylsulfanylhexa-3,5-dien-2-yl]-7-N-[(3E,8E)-4,9-dimethyl-11-oxoundeca-1,3,8-trien-5-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143344545 |
| Molecular Formula | C28H33N7O3S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 5-N-[(3Z,5E)-6-cyano-3-methylsulfanylhexa-3,5-dien-2-yl]-7-N-[(3E,8E)-4,9-dimethyl-11-oxoundeca-1,3,8-trien-5-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | C=C/C=C(\C)C(CC/C=C(\C)CC=O)NC(=O)c1cc(C(=O)NC(C)/C(=C/C=C/C#N)SC)nc2ncnn12 |
| InChI | InChI=1S/C28H33N7O3S/c1-6-10-20(3)22(12-9-11-19(2)14-16-36)33-27(38)24-17-23(34-28-30-18-31-35(24)28)26(37)32-21(4)25(39-5)13-7-8-15-29/h6-8,10-11,13,16-18,21-22H,1,9,12,14H2,2-5H3,(H,32,37)(H,33,38)/b8-7+,19-11+,20-10+,25-13- |
| InChIKey | XUWGUVUTEOZSHN-GMJJSGHASA-N |
| XLogP | 4.12 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|