C26H32ClFN6O4 — CID 143346555
(3E,8E)-7-[[5-[[(2E,4Z)-4-chloro-2-ethyl-5-fluorohexa-2,4-dienyl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-8-methyldeca-3,8-dienoic acid (PubChem CID 143346555) has the molecular formula C26H32ClFN6O4 and a molecular weight of 547.03 g/mol. Its IUPAC name is (3E,8E)-7-[[5-[[(2E,4Z)-4-chloro-2-ethyl-5-fluorohexa-2,4-dienyl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-8-methyldeca-3,8-dienoic acid.
| Compound Name | (3E,8E)-7-[[5-[[(2E,4Z)-4-chloro-2-ethyl-5-fluorohexa-2,4-dienyl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-8-methyldeca-3,8-dienoic acid |
|---|---|
| PubChem CID | 143346555 |
| Molecular Formula | C26H32ClFN6O4 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (3E,8E)-7-[[5-[[(2E,4Z)-4-chloro-2-ethyl-5-fluorohexa-2,4-dienyl]carbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-8-methyldeca-3,8-dienoic acid |
| SMILES | C/C=C(\C)C(CC/C=C/CC(=O)O)NC(=O)c1cc(C(=O)NC/C(=C/C(Cl)=C(\C)F)CC)nc2ncnn12 |
| InChI | InChI=1S/C26H32ClFN6O4/c1-5-16(3)20(10-8-7-9-11-23(35)36)32-25(38)22-13-21(33-26-30-15-31-34(22)26)24(37)29-14-18(6-2)12-19(27)17(4)28/h5,7,9,12-13,15,20H,6,8,10-11,14H2,1-4H3,(H,29,37)(H,32,38)(H,35,36)/b9-7+,16-5+,18-12+,19-17- |
| InChIKey | BTKUEFJIUCWIRB-XHNVITDSSA-N |
| XLogP | 4.51 |
| TPSA | 138.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|